Diethyl ether [(CH3CH2)2O] is an organic compound of three elements: Carbon, Hydrogen, and Oxygen. The molecular weight of Diethyl ether is 74.1222 which can be calculated by adding up the total weight (atomic weight multiplied by their number) of all its elements.
Carbon dioxide [CO2] is an inorganic compound of two elements: Carbon (C) and Oxygen (O). The molecular weight of Carbon dioxide is 44.0095 which can be calculated by adding up the total weight (atomic weight multiplied by their number) of all its elements.
The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…