9-Crown-3 [C6H12O3] Molecular Weight Calculation

The molecular weight of 9-Crown-3 [C6H12O3] is 132.1584. To calculate molecular weight of any compound, the first step is to…

Solketal (1,2-Isopropylideneglycerol) [C6H12O3] Molecular Weight Calculation

The molecular weight of Solketal [C6H12O3] is 132.1584. To calculate molecular weight of any compound, the first step is to…

Propylene Glycol Methyl Ether Acetate [CH3CO2CH(CH3)CH2OCH3] Molecular Weight Calculation

The molecular weight of Propylene glycol methyl ether acetate [CH3CO2CH(CH3)CH2OCH3] is 132.1584. To calculate molecular weight of any compound, the…

1-Methoxypropane (Methyl propyl ether) [C4H10O] Molecular Weight Calculation

The molecular weight of 1-Methoxypropane [C4H10O] is 74.1222. To calculate molecular weight of any compound, the first step is to…

Isobutanol [(CH3)2CHCH2OH] Molecular Weight Calculation

The molecular weight of Isobutanol [C4H10O] is 74.1222. To calculate molecular weight of any compound, the first step is to…

tert-Butanol [(CH3)3COH] Molecular Weight Calculation

The molecular weight of tert-Butanol [(CH3)3COH] is 74.1222. To calculate molecular weight of any compound, the first step is to…

2-Butanol (sec-butanol) [C2H5CH(OH)CH3] Molecular Weight Calculation

The molecular weight of 2-Butanol [C2H5CH(OH)CH3] is 74.1222. To calculate molecular weight of any compound, the first step is to…

n-Butanol (1-Butanol) [CH3(CH2)3OH] Molecular Weight Calculation

The molecular weight of n-Butanol [CH3(CH2)3OH] is 74.1222. To calculate molecular weight of any compound, the first step is to…

Diethyl Ether [(CH3CH2)2O] Molecular Weight Calculation

Diethyl Ether [(CH3CH2)2O] Molecular Weight Calculation

Diethyl ether [(CH3CH2)2O] is an organic compound of three elements: Carbon, Hydrogen, and Oxygen. The molecular weight of Diethyl ether is 74.1222 which can be calculated by adding up the total weight (atomic weight multiplied by their number) of all its elements.

Decahydroxycyclopentane [C5(OH)10] Molecular Weight Calculation

The molecular weight of Decahydroxycyclopentane [C5(OH)10] is 230.1275. To calculate molecular weight of any compound, the first step is to…

Carbon Monoxide [CO] Molecular Weight Calculation

The molecular weight of Carbon monoxide [CO] is 28.0101. To calculate molecular weight of any compound, the first step is…

Carbon dioxide [CO2] Molecular Weight Calculation

Carbon Dioxide [CO2] Molecular Weight Calculation

Carbon dioxide [CO2] is an inorganic compound of two elements: Carbon (C)  and Oxygen (O). The molecular weight of Carbon dioxide is 44.0095 which can be calculated by adding up the total weight (atomic weight multiplied by their number) of all its elements.

Dihydroxymalonic Acid [C3H4O6] Molecular Weight Calculation

The molecular weight of Dihydroxymalonic acid [C3H4O6] is 136.0605. To calculate molecular weight of any compound, the first step is…

Triethylene Glycol [HOCH2CH2OCH2CH2OCH2CH2OH] Molecular Weight Calculation

The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…

Methanediol [CH2(OH)2] Molecular Weight Calculation

The molecular weight of Methanediol [CH2(OH)2] is 116.159. To calculate molecular weight of any compound, the first step is to know…