| Chemical Name | SP600125 |
| Synonym | SP 600125, 1,9-Pyrazoloanthrone, Anthrapyrazolone |
| Molecular formula | C14H8N2O |
| Molecular Weight | 220.23 |
| CAS Number | 129-56-6 |
| Color | Yellow |
| Solubility in DMSO | 20 mg/ml, form clear to slightly hazy, yellowish solution |
| Solubility in water | Insoluble |
| SMILES string | O=C1c2ccccc2-c3n[nH]c4cccc1c34 |
| InChI | 1S/C14H8N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7H,(H,15,16) |
| InChI key | ACPOUJIDANTYHO-UHFFFAOYSA-N |
| Molecular Structure |  |
Was this post helpful?
Let us know if you liked the post. That’s the only way we can improve.
