| Synonyms | Desoxycholic acid sodium salt, 3α,12α-Dihydroxy-5β-cholanic acid sodium salt, 7-Deoxycholic acid sodium salt, Sodium deoxycholate |
| ChemSpider | 82577 |
| PubChem CID | 23668196 |
| UNII | 436LS6U35Y |
| InChIKey | FHHPUSMSKHSNKW-SMOYURAASA-M |
| CAS Number | 302-95-4 |
| SMILES string | [Na+].[H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@H]([C@H](C)CCC([O-])=O)[C@@]4(C)[C@@H](O)C[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | 1S/C24H40O4.Na/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3;/h14-21,25-26H,4-13H2,1-3H3,(H,27,28);/q;+1/p-1/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-;/m1./s1 |
| EC Number | 206-132-7 |
| Molecular formula | C24H39NaO4 |
| Molecular weight | 414.55 |
| Micellar average molecular weight | 1200-5000 |
| Aggregation number | 3 – 12 |
| Appearance | White powder |
| Odour | ? |
| Solubility | Water soluble (100 mg/ml), form clear, colourless or slightly yellowish solution in water |
| Chemical type | Detergent, Ionic detergent |
Was this post helpful?
Let us know if you liked the post. That’s the only way we can improve.
