Category: Molecular Weight Calculations

Triethylene Glycol [HOCH2CH2OCH2CH2OCH2CH2OH] Molecular Weight Calculation

The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…

Propyl Propionate (Propyl Propanoate) [CH3CH2COOCH2CH2CH3] Molecular Weight Calculation

The molecular weight of Propyl propionate [CH3CH2COOCH2CH2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

Methyl Pivalate [(CH3)3CCOOCH3] Molecular Weight Calculation

The molecular weight of Methyl pivalate [(CH3)3CCOOCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

4-Methylpentanoic Acid [(CH3)2CHCH2CH2CO2H] Molecular Weight Calculation

The molecular weight of 4-Methylpentanoic acid [(CH3)2CHCH2CH2CO2H] is 116.159. To calculate molecular weight of any compound, the first step is to…

Methyl Valerate (Methyl Pentanoate) [CH3(CH2)3CO2CH3] Molecular Weight Calculation

The molecular weight of Methyl valerate [CH3(CH2)3CO2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

Isobutyl acetate [CH3COOCH2CH(CH3)2] Molecular Weight Calculation

The molecular weight of Isobutyl acetate [CH3COOCH2CH(CH3)2] is 116.159. To calculate molecular weight of any compound, the first step is to…

Hexanoic acid (Caproic acid) [CH3(CH2)4COOH] Molecular Weight Calculation

The molecular weight of Hexanoic acid [CH3(CH2)4COOH] is 116.159. To calculate molecular weight of any compound, the first step is to…

Ethyl Butyrate [CH3CH2CH2C(O)OC2H5] Molecular Weight Calculation

The molecular weight of Ethyl butyrate [CH3CH2CH2C(O)OC2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…

Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] Molecular Weight Calculation

The molecular weight of Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

1,2-Cyclohexanediol [C6H10(OH)2] Molecular Weight Calculation

The molecular weight of 1,2-Cyclohexanediol [C6H10(OH)2] is 116.159. To calculate molecular weight of any compound, the first step is to know…

tert-Butyl Acetate [CH3COOC(CH3)] Molecular Weight Calculation

The molecular weight of tert-Butyl acetate [CH3COOC(CH3)] is 116.159. To calculate molecular weight of any compound, the first step is to…

sec-Butyl acetate [CH3CO2CH(CH3)C2H5] Molecular Weight Calculation

The molecular weight of sec-Butyl acetate [CH3CO2CH(CH3)C2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…

Butyl Acetate (n-Butyl Acetate) [CH3COO(CH2)3CH3] Molecular Weight Calculation

The molecular weight of Butyl acetate (CH3COO(CH2)3CH3) is 116.159. To calculate molecular weight of any compound, the first step is…

Tetrahydrofuran [(CH2)4O] Molecular Weight Calculation

The molecular weight of Tetrahydrofuran [(CH2)4O] is 72.1062. To calculate molecular weight of any compound, the first step is to…

2-Methoxypropene [CH2C(CH3)OCH3] Molecular Weight Calculation

The molecular weight of 2-Methoxypropene [CH2C(CH3)OCH3] is 72.1062. To calculate molecular weight of any compound, the first step is to…