Laboratory Notes
The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Propyl propionate [CH3CH2COOCH2CH2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Methyl pivalate [(CH3)3CCOOCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of 4-Methylpentanoic acid [(CH3)2CHCH2CH2CO2H] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Methyl valerate [CH3(CH2)3CO2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Isobutyl acetate [CH3COOCH2CH(CH3)2] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Hexanoic acid [CH3(CH2)4COOH] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Ethyl butyrate [CH3CH2CH2C(O)OC2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of 1,2-Cyclohexanediol [C6H10(OH)2] is 116.159. To calculate molecular weight of any compound, the first step is to know…
The molecular weight of tert-Butyl acetate [CH3COOC(CH3)] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of sec-Butyl acetate [CH3CO2CH(CH3)C2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…
The molecular weight of Butyl acetate (CH3COO(CH2)3CH3) is 116.159. To calculate molecular weight of any compound, the first step is…
The molecular weight of Tetrahydrofuran [(CH2)4O] is 72.1062. To calculate molecular weight of any compound, the first step is to…
The molecular weight of 2-Methoxypropene [CH2C(CH3)OCH3] is 72.1062. To calculate molecular weight of any compound, the first step is to…
Copyright © 2024 Laboratory Notes
Design by ThemesDNA.com