Category: Database: Molecular Weight Calculations
Triethylene Glycol [HOCH2CH2OCH2CH2OCH2CH2OH] Molecular Weight Calculation
The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…
Propyl Propionate (Propyl Propanoate) [CH3CH2COOCH2CH2CH3] Molecular Weight Calculation
The molecular weight of Propyl propionate [CH3CH2COOCH2CH2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
Methyl Pivalate [(CH3)3CCOOCH3] Molecular Weight Calculation
The molecular weight of Methyl pivalate [(CH3)3CCOOCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
4-Methylpentanoic Acid [(CH3)2CHCH2CH2CO2H] Molecular Weight Calculation
The molecular weight of 4-Methylpentanoic acid [(CH3)2CHCH2CH2CO2H] is 116.159. To calculate molecular weight of any compound, the first step is to…
Methyl Valerate (Methyl Pentanoate) [CH3(CH2)3CO2CH3] Molecular Weight Calculation
The molecular weight of Methyl valerate [CH3(CH2)3CO2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
Isobutyl acetate [CH3COOCH2CH(CH3)2] Molecular Weight Calculation
The molecular weight of Isobutyl acetate [CH3COOCH2CH(CH3)2] is 116.159. To calculate molecular weight of any compound, the first step is to…
Hexanoic acid (Caproic acid) [CH3(CH2)4COOH] Molecular Weight Calculation
The molecular weight of Hexanoic acid [CH3(CH2)4COOH] is 116.159. To calculate molecular weight of any compound, the first step is to…
Ethyl Butyrate [CH3CH2CH2C(O)OC2H5] Molecular Weight Calculation
The molecular weight of Ethyl butyrate [CH3CH2CH2C(O)OC2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…
Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] Molecular Weight Calculation
The molecular weight of Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…
1,2-Cyclohexanediol [C6H10(OH)2] Molecular Weight Calculation
The molecular weight of 1,2-Cyclohexanediol [C6H10(OH)2] is 116.159. To calculate molecular weight of any compound, the first step is to know…
tert-Butyl Acetate [CH3COOC(CH3)] Molecular Weight Calculation
The molecular weight of tert-Butyl acetate [CH3COOC(CH3)] is 116.159. To calculate molecular weight of any compound, the first step is to…
sec-Butyl acetate [CH3CO2CH(CH3)C2H5] Molecular Weight Calculation
The molecular weight of sec-Butyl acetate [CH3CO2CH(CH3)C2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…
Butyl Acetate (n-Butyl Acetate) [CH3COO(CH2)3CH3] Molecular Weight Calculation
The molecular weight of Butyl acetate (CH3COO(CH2)3CH3) is 116.159. To calculate molecular weight of any compound, the first step is…
Tetrahydrofuran [(CH2)4O] Molecular Weight Calculation
The molecular weight of Tetrahydrofuran [(CH2)4O] is 72.1062. To calculate molecular weight of any compound, the first step is to…
2-Methoxypropene [CH2C(CH3)OCH3] Molecular Weight Calculation
The molecular weight of 2-Methoxypropene [CH2C(CH3)OCH3] is 72.1062. To calculate molecular weight of any compound, the first step is to…