Category: Lab Notes: Laboratory Calculations

Carbon Monoxide [CO] Molecular Weight Calculation

Loading

The molecular weight of Carbon monoxide [CO] is 28.0101. To calculate molecular weight of any compound, the first step is…

Carbon dioxide [CO2] Molecular Weight Calculation

Carbon Dioxide [CO2] Molecular Weight Calculation

Loading

Carbon dioxide [CO2] is an inorganic compound of two elements: Carbon (C)  and Oxygen (O). The molecular weight of Carbon dioxide is 44.0095 which can be calculated by adding up the total weight (atomic weight multiplied by their number) of all its elements.

Dihydroxymalonic Acid [C3H4O6] Molecular Weight Calculation

Loading

The molecular weight of Dihydroxymalonic acid [C3H4O6] is 136.0605. To calculate molecular weight of any compound, the first step is…

Triethylene Glycol [HOCH2CH2OCH2CH2OCH2CH2OH] Molecular Weight Calculation

Loading

The molecular weight of Triethylene glycol [HOCH2CH2OCH2CH2OCH2CH2OH] is 150.1738. To calculate molecular weight of any compound, the first step is to…

Propyl Propionate (Propyl Propanoate) [CH3CH2COOCH2CH2CH3] Molecular Weight Calculation

Loading

The molecular weight of Propyl propionate [CH3CH2COOCH2CH2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

Methyl Pivalate [(CH3)3CCOOCH3] Molecular Weight Calculation

Loading

The molecular weight of Methyl pivalate [(CH3)3CCOOCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

4-Methylpentanoic Acid [(CH3)2CHCH2CH2CO2H] Molecular Weight Calculation

Loading

The molecular weight of 4-Methylpentanoic acid [(CH3)2CHCH2CH2CO2H] is 116.159. To calculate molecular weight of any compound, the first step is to…

Methyl Valerate (Methyl Pentanoate) [CH3(CH2)3CO2CH3] Molecular Weight Calculation

Loading

The molecular weight of Methyl valerate [CH3(CH2)3CO2CH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

Isobutyl acetate [CH3COOCH2CH(CH3)2] Molecular Weight Calculation

Loading

The molecular weight of Isobutyl acetate [CH3COOCH2CH(CH3)2] is 116.159. To calculate molecular weight of any compound, the first step is to…

Hexanoic acid (Caproic acid) [CH3(CH2)4COOH] Molecular Weight Calculation

Loading

The molecular weight of Hexanoic acid [CH3(CH2)4COOH] is 116.159. To calculate molecular weight of any compound, the first step is to…

Ethyl Butyrate [CH3CH2CH2C(O)OC2H5] Molecular Weight Calculation

Loading

The molecular weight of Ethyl butyrate [CH3CH2CH2C(O)OC2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…

Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] Molecular Weight Calculation

Loading

The molecular weight of Diacetone Alcohol [(CH3)2C(OH)CH2COCH3] is 116.159. To calculate molecular weight of any compound, the first step is to…

1,2-Cyclohexanediol [C6H10(OH)2] Molecular Weight Calculation

Loading

The molecular weight of 1,2-Cyclohexanediol [C6H10(OH)2] is 116.159. To calculate molecular weight of any compound, the first step is to know…

tert-Butyl Acetate [CH3COOC(CH3)] Molecular Weight Calculation

Loading

The molecular weight of tert-Butyl acetate [CH3COOC(CH3)] is 116.159. To calculate molecular weight of any compound, the first step is to…

sec-Butyl acetate [CH3CO2CH(CH3)C2H5] Molecular Weight Calculation

Loading

The molecular weight of sec-Butyl acetate [CH3CO2CH(CH3)C2H5] is 116.159. To calculate molecular weight of any compound, the first step is to…